C18H22N2O5S — CID 17142002
ethyl (E)-4-oxo-4-[[3-(oxolan-2-ylmethoxy)phenyl]carbamothioylamino]but-2-enoate (PubChem CID 17142002) has the molecular formula C18H22N2O5S and a molecular weight of 378.45 g/mol. Its IUPAC name is ethyl (E)-4-oxo-4-[[3-(oxolan-2-ylmethoxy)phenyl]carbamothioylamino]but-2-enoate.
| Compound Name | ethyl (E)-4-oxo-4-[[3-(oxolan-2-ylmethoxy)phenyl]carbamothioylamino]but-2-enoate |
|---|---|
| PubChem CID | 17142002 |
| Molecular Formula | C18H22N2O5S |
| Molecular Weight | 378.45 g/mol |
| Exact Mass | 378.12 |
| IUPAC Name | ethyl (E)-4-oxo-4-[[3-(oxolan-2-ylmethoxy)phenyl]carbamothioylamino]but-2-enoate |
| SMILES | CCOC(=O)/C=C/C(=O)NC(=S)Nc1cccc(OCC2CCCO2)c1 |
| InChI | InChI=1S/C18H22N2O5S/c1-2-23-17(22)9-8-16(21)20-18(26)19-13-5-3-6-14(11-13)25-12-15-7-4-10-24-15/h3,5-6,8-9,11,15H,2,4,7,10,12H2,1H3,(H2,19,20,21,26)/b9-8+ |
| InChIKey | OHUSKXNWXCYSDU-CMDGGOBGSA-N |
| XLogP | 2.18 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.45 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|