C18H24N2O4S — CID 17097399
ethyl (E)-4-[[3-(3-methylbutoxy)phenyl]carbamothioylamino]-4-oxobut-2-enoate (PubChem CID 17097399) has the molecular formula C18H24N2O4S and a molecular weight of 364.47 g/mol. Its IUPAC name is ethyl (E)-4-[[3-(3-methylbutoxy)phenyl]carbamothioylamino]-4-oxobut-2-enoate.
| Compound Name | ethyl (E)-4-[[3-(3-methylbutoxy)phenyl]carbamothioylamino]-4-oxobut-2-enoate |
|---|---|
| PubChem CID | 17097399 |
| Molecular Formula | C18H24N2O4S |
| Molecular Weight | 364.47 g/mol |
| Exact Mass | 364.15 |
| IUPAC Name | ethyl (E)-4-[[3-(3-methylbutoxy)phenyl]carbamothioylamino]-4-oxobut-2-enoate |
| SMILES | CCOC(=O)/C=C/C(=O)NC(=S)Nc1cccc(OCCC(C)C)c1 |
| InChI | InChI=1S/C18H24N2O4S/c1-4-23-17(22)9-8-16(21)20-18(25)19-14-6-5-7-15(12-14)24-11-10-13(2)3/h5-9,12-13H,4,10-11H2,1-3H3,(H2,19,20,21,25)/b9-8+ |
| InChIKey | RBJFKZRPMYTCEW-CMDGGOBGSA-N |
| XLogP | 3.04 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.47 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|