C17H21N3O4S — CID 17187709
ethyl (E)-4-[[3-(butanoylamino)phenyl]carbamothioylamino]-4-oxobut-2-enoate (PubChem CID 17187709) has the molecular formula C17H21N3O4S and a molecular weight of 363.44 g/mol. Its IUPAC name is ethyl (E)-4-[[3-(butanoylamino)phenyl]carbamothioylamino]-4-oxobut-2-enoate.
| Compound Name | ethyl (E)-4-[[3-(butanoylamino)phenyl]carbamothioylamino]-4-oxobut-2-enoate |
|---|---|
| PubChem CID | 17187709 |
| Molecular Formula | C17H21N3O4S |
| Molecular Weight | 363.44 g/mol |
| Exact Mass | 363.13 |
| IUPAC Name | ethyl (E)-4-[[3-(butanoylamino)phenyl]carbamothioylamino]-4-oxobut-2-enoate |
| SMILES | CCCC(=O)Nc1cccc(NC(=S)NC(=O)/C=C/C(=O)OCC)c1 |
| InChI | InChI=1S/C17H21N3O4S/c1-3-6-14(21)18-12-7-5-8-13(11-12)19-17(25)20-15(22)9-10-16(23)24-4-2/h5,7-11H,3-4,6H2,1-2H3,(H,18,21)(H2,19,20,22,25)/b10-9+ |
| InChIKey | HZIQACVMEISLIJ-MDZDMXLPSA-N |
| XLogP | 2.36 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.44 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|