C19H18N4O3S — CID 6234621
ethyl (E)-4-oxo-4-[(4-phenyldiazenylphenyl)carbamothioylamino]but-2-enoate (PubChem CID 6234621) has the molecular formula C19H18N4O3S and a molecular weight of 382.45 g/mol. Its IUPAC name is ethyl (E)-4-oxo-4-[(4-phenyldiazenylphenyl)carbamothioylamino]but-2-enoate.
| Compound Name | ethyl (E)-4-oxo-4-[(4-phenyldiazenylphenyl)carbamothioylamino]but-2-enoate |
|---|---|
| PubChem CID | 6234621 |
| Molecular Formula | C19H18N4O3S |
| Molecular Weight | 382.45 g/mol |
| Exact Mass | 382.11 |
| IUPAC Name | ethyl (E)-4-oxo-4-[(4-phenyldiazenylphenyl)carbamothioylamino]but-2-enoate |
| SMILES | CCOC(=O)/C=C/C(=O)NC(=S)Nc1ccc(/N=N/c2ccccc2)cc1 |
| InChI | InChI=1S/C19H18N4O3S/c1-2-26-18(25)13-12-17(24)21-19(27)20-14-8-10-16(11-9-14)23-22-15-6-4-3-5-7-15/h3-13H,2H2,1H3,(H2,20,21,24,27)/b13-12+,23-22+ |
| InChIKey | CBOCHXRFCIBVGX-JLOFEOLUSA-N |
| XLogP | 4.03 |
| TPSA | 92.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.45 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|