C13H13N3O5S — CID 3501991
ethyl 4-[(4-nitrophenyl)carbamothioylamino]-4-oxobut-2-enoate (PubChem CID 3501991) has the molecular formula C13H13N3O5S and a molecular weight of 323.33 g/mol. Its IUPAC name is ethyl 4-[(4-nitrophenyl)carbamothioylamino]-4-oxobut-2-enoate.
| Compound Name | ethyl 4-[(4-nitrophenyl)carbamothioylamino]-4-oxobut-2-enoate |
|---|---|
| PubChem CID | 3501991 |
| Molecular Formula | C13H13N3O5S |
| Molecular Weight | 323.33 g/mol |
| Exact Mass | 323.06 |
| IUPAC Name | ethyl 4-[(4-nitrophenyl)carbamothioylamino]-4-oxobut-2-enoate |
| SMILES | CCOC(=O)C=CC(=O)NC(=S)Nc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C13H13N3O5S/c1-2-21-12(18)8-7-11(17)15-13(22)14-9-3-5-10(6-4-9)16(19)20/h3-8H,2H2,1H3,(H2,14,15,17,22) |
| InChIKey | MCFLVQBOJINOGQ-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 110.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.33 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|