C16H21N3O5S2 — CID 4932992
ethyl 4-oxo-4-[[4-(propylsulfamoyl)phenyl]carbamothioylamino]but-2-enoate (PubChem CID 4932992) has the molecular formula C16H21N3O5S2 and a molecular weight of 399.49 g/mol. Its IUPAC name is ethyl 4-oxo-4-[[4-(propylsulfamoyl)phenyl]carbamothioylamino]but-2-enoate.
| Compound Name | ethyl 4-oxo-4-[[4-(propylsulfamoyl)phenyl]carbamothioylamino]but-2-enoate |
|---|---|
| PubChem CID | 4932992 |
| Molecular Formula | C16H21N3O5S2 |
| Molecular Weight | 399.49 g/mol |
| Exact Mass | 399.09 |
| IUPAC Name | ethyl 4-oxo-4-[[4-(propylsulfamoyl)phenyl]carbamothioylamino]but-2-enoate |
| SMILES | CCCNS(=O)(=O)c1ccc(NC(=S)NC(=O)C=CC(=O)OCC)cc1 |
| InChI | InChI=1S/C16H21N3O5S2/c1-3-11-17-26(22,23)13-7-5-12(6-8-13)18-16(25)19-14(20)9-10-15(21)24-4-2/h5-10,17H,3-4,11H2,1-2H3,(H2,18,19,20,25) |
| InChIKey | BRHJKWASYSBYBP-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.49 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|