C15H23N3O3S2 — CID 4932989
N-[[4-(propylsulfamoyl)phenyl]carbamothioyl]pentanamide (PubChem CID 4932989) has the molecular formula C15H23N3O3S2 and a molecular weight of 357.50 g/mol. Its IUPAC name is N-[[4-(propylsulfamoyl)phenyl]carbamothioyl]pentanamide.
| Compound Name | N-[[4-(propylsulfamoyl)phenyl]carbamothioyl]pentanamide |
|---|---|
| PubChem CID | 4932989 |
| Molecular Formula | C15H23N3O3S2 |
| Molecular Weight | 357.50 g/mol |
| Exact Mass | 357.12 |
| IUPAC Name | N-[[4-(propylsulfamoyl)phenyl]carbamothioyl]pentanamide |
| SMILES | CCCCC(=O)NC(=S)Nc1ccc(S(=O)(=O)NCCC)cc1 |
| InChI | InChI=1S/C15H23N3O3S2/c1-3-5-6-14(19)18-15(22)17-12-7-9-13(10-8-12)23(20,21)16-11-4-2/h7-10,16H,3-6,11H2,1-2H3,(H2,17,18,19,22) |
| InChIKey | CKMPLSQZUIJGLG-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.50 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|