C16H28ClN3O3S — CID 119720435
7-amino-N-[4-(propylsulfamoyl)phenyl]heptanamide;hydrochloride (PubChem CID 119720435) has the molecular formula C16H28ClN3O3S and a molecular weight of 377.94 g/mol. Its IUPAC name is 7-amino-N-[4-(propylsulfamoyl)phenyl]heptanamide;hydrochloride.
| Compound Name | 7-amino-N-[4-(propylsulfamoyl)phenyl]heptanamide;hydrochloride |
|---|---|
| PubChem CID | 119720435 |
| Molecular Formula | C16H28ClN3O3S |
| Molecular Weight | 377.94 g/mol |
| Exact Mass | 377.15 |
| IUPAC Name | 7-amino-N-[4-(propylsulfamoyl)phenyl]heptanamide;hydrochloride |
| SMILES | CCCNS(=O)(=O)c1ccc(NC(=O)CCCCCCN)cc1.Cl |
| InChI | InChI=1S/C16H27N3O3S.ClH/c1-2-13-18-23(21,22)15-10-8-14(9-11-15)19-16(20)7-5-3-4-6-12-17;/h8-11,18H,2-7,12-13,17H2,1H3,(H,19,20);1H |
| InChIKey | SCIOYCRRUTXATD-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.94 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|