C14H22N2O3S — CID 17321429
N-[4-(propylsulfamoyl)phenyl]pentanamide (PubChem CID 17321429) has the molecular formula C14H22N2O3S and a molecular weight of 298.41 g/mol. Its IUPAC name is N-[4-(propylsulfamoyl)phenyl]pentanamide.
| Compound Name | N-[4-(propylsulfamoyl)phenyl]pentanamide |
|---|---|
| PubChem CID | 17321429 |
| Molecular Formula | C14H22N2O3S |
| Molecular Weight | 298.41 g/mol |
| Exact Mass | 298.14 |
| IUPAC Name | N-[4-(propylsulfamoyl)phenyl]pentanamide |
| SMILES | CCCCC(=O)Nc1ccc(S(=O)(=O)NCCC)cc1 |
| InChI | InChI=1S/C14H22N2O3S/c1-3-5-6-14(17)16-12-7-9-13(10-8-12)20(18,19)15-11-4-2/h7-10,15H,3-6,11H2,1-2H3,(H,16,17) |
| InChIKey | MFHUKLVDSAZUPW-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.41 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |