C21H28FN3O5S2 — CID 17192252
3-[(4-fluorophenyl)sulfonylamino]-N-[4-(hexylsulfamoyl)phenyl]propanamide (PubChem CID 17192252) has the molecular formula C21H28FN3O5S2 and a molecular weight of 485.60 g/mol. Its IUPAC name is 3-[(4-fluorophenyl)sulfonylamino]-N-[4-(hexylsulfamoyl)phenyl]propanamide.
| Compound Name | 3-[(4-fluorophenyl)sulfonylamino]-N-[4-(hexylsulfamoyl)phenyl]propanamide |
|---|---|
| PubChem CID | 17192252 |
| Molecular Formula | C21H28FN3O5S2 |
| Molecular Weight | 485.60 g/mol |
| Exact Mass | 485.15 |
| IUPAC Name | 3-[(4-fluorophenyl)sulfonylamino]-N-[4-(hexylsulfamoyl)phenyl]propanamide |
| SMILES | CCCCCCNS(=O)(=O)c1ccc(NC(=O)CCNS(=O)(=O)c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C21H28FN3O5S2/c1-2-3-4-5-15-23-31(27,28)20-12-8-18(9-13-20)25-21(26)14-16-24-32(29,30)19-10-6-17(22)7-11-19/h6-13,23-24H,2-5,14-16H2,1H3,(H,25,26) |
| InChIKey | SCLJCFWZCJEJQD-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 121.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.60 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|