C20H26FN3O5S2 — CID 24640292
N-[4-(diethylsulfamoyl)phenyl]-4-[(4-fluorophenyl)sulfonylamino]butanamide (PubChem CID 24640292) has the molecular formula C20H26FN3O5S2 and a molecular weight of 471.58 g/mol. Its IUPAC name is N-[4-(diethylsulfamoyl)phenyl]-4-[(4-fluorophenyl)sulfonylamino]butanamide.
| Compound Name | N-[4-(diethylsulfamoyl)phenyl]-4-[(4-fluorophenyl)sulfonylamino]butanamide |
|---|---|
| PubChem CID | 24640292 |
| Molecular Formula | C20H26FN3O5S2 |
| Molecular Weight | 471.58 g/mol |
| Exact Mass | 471.13 |
| IUPAC Name | N-[4-(diethylsulfamoyl)phenyl]-4-[(4-fluorophenyl)sulfonylamino]butanamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(NC(=O)CCCNS(=O)(=O)c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C20H26FN3O5S2/c1-3-24(4-2)31(28,29)19-13-9-17(10-14-19)23-20(25)6-5-15-22-30(26,27)18-11-7-16(21)8-12-18/h7-14,22H,3-6,15H2,1-2H3,(H,23,25) |
| InChIKey | QQBCGRLVQHNMGT-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.58 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|