C17H20FN3O5S2 — CID 24635402
4-[(4-fluorophenyl)sulfonylamino]-N-[4-(methylsulfamoyl)phenyl]butanamide (PubChem CID 24635402) has the molecular formula C17H20FN3O5S2 and a molecular weight of 429.50 g/mol. Its IUPAC name is 4-[(4-fluorophenyl)sulfonylamino]-N-[4-(methylsulfamoyl)phenyl]butanamide.
| Compound Name | 4-[(4-fluorophenyl)sulfonylamino]-N-[4-(methylsulfamoyl)phenyl]butanamide |
|---|---|
| PubChem CID | 24635402 |
| Molecular Formula | C17H20FN3O5S2 |
| Molecular Weight | 429.50 g/mol |
| Exact Mass | 429.08 |
| IUPAC Name | 4-[(4-fluorophenyl)sulfonylamino]-N-[4-(methylsulfamoyl)phenyl]butanamide |
| SMILES | CNS(=O)(=O)c1ccc(NC(=O)CCCNS(=O)(=O)c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C17H20FN3O5S2/c1-19-27(23,24)15-10-6-14(7-11-15)21-17(22)3-2-12-20-28(25,26)16-8-4-13(18)5-9-16/h4-11,19-20H,2-3,12H2,1H3,(H,21,22) |
| InChIKey | GJVYIYVXKHIFKA-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 121.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.50 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|