C16H19FN4O5S2 — CID 55558986
4-[(4-fluorophenyl)sulfonylamino]-N-[3-(sulfamoylamino)phenyl]butanamide (PubChem CID 55558986) has the molecular formula C16H19FN4O5S2 and a molecular weight of 430.48 g/mol. Its IUPAC name is 4-[(4-fluorophenyl)sulfonylamino]-N-[3-(sulfamoylamino)phenyl]butanamide.
| Compound Name | 4-[(4-fluorophenyl)sulfonylamino]-N-[3-(sulfamoylamino)phenyl]butanamide |
|---|---|
| PubChem CID | 55558986 |
| Molecular Formula | C16H19FN4O5S2 |
| Molecular Weight | 430.48 g/mol |
| Exact Mass | 430.08 |
| IUPAC Name | 4-[(4-fluorophenyl)sulfonylamino]-N-[3-(sulfamoylamino)phenyl]butanamide |
| SMILES | NS(=O)(=O)Nc1cccc(NC(=O)CCCNS(=O)(=O)c2ccc(F)cc2)c1 |
| InChI | InChI=1S/C16H19FN4O5S2/c17-12-6-8-15(9-7-12)27(23,24)19-10-2-5-16(22)20-13-3-1-4-14(11-13)21-28(18,25)26/h1,3-4,6-9,11,19,21H,2,5,10H2,(H,20,22)(H2,18,25,26) |
| InChIKey | HUFUQGSJLRIZSC-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 147.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.48 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|