C11H16BrN3O3S — CID 107908922
5-bromo-N-[3-(sulfamoylamino)phenyl]pentanamide (PubChem CID 107908922) has the molecular formula C11H16BrN3O3S and a molecular weight of 350.24 g/mol. Its IUPAC name is 5-bromo-N-[3-(sulfamoylamino)phenyl]pentanamide.
| Compound Name | 5-bromo-N-[3-(sulfamoylamino)phenyl]pentanamide |
|---|---|
| PubChem CID | 107908922 |
| Molecular Formula | C11H16BrN3O3S |
| Molecular Weight | 350.24 g/mol |
| Exact Mass | 349.01 |
| IUPAC Name | 5-bromo-N-[3-(sulfamoylamino)phenyl]pentanamide |
| SMILES | NS(=O)(=O)Nc1cccc(NC(=O)CCCCBr)c1 |
| InChI | InChI=1S/C11H16BrN3O3S/c12-7-2-1-6-11(16)14-9-4-3-5-10(8-9)15-19(13,17)18/h3-5,8,15H,1-2,6-7H2,(H,14,16)(H2,13,17,18) |
| InChIKey | GEVPTFGEWQTWQM-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.24 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|