C12H17N3O4S — CID 47211352
2-(oxolan-2-yl)-N-[3-(sulfamoylamino)phenyl]acetamide (PubChem CID 47211352) has the molecular formula C12H17N3O4S and a molecular weight of 299.35 g/mol. Its IUPAC name is 2-(oxolan-2-yl)-N-[3-(sulfamoylamino)phenyl]acetamide.
| Compound Name | 2-(oxolan-2-yl)-N-[3-(sulfamoylamino)phenyl]acetamide |
|---|---|
| PubChem CID | 47211352 |
| Molecular Formula | C12H17N3O4S |
| Molecular Weight | 299.35 g/mol |
| Exact Mass | 299.09 |
| IUPAC Name | 2-(oxolan-2-yl)-N-[3-(sulfamoylamino)phenyl]acetamide |
| SMILES | NS(=O)(=O)Nc1cccc(NC(=O)CC2CCCO2)c1 |
| InChI | InChI=1S/C12H17N3O4S/c13-20(17,18)15-10-4-1-3-9(7-10)14-12(16)8-11-5-2-6-19-11/h1,3-4,7,11,15H,2,5-6,8H2,(H,14,16)(H2,13,17,18) |
| InChIKey | DHKZYMUDCHXLHD-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.35 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |