C12H13BrClNO2 — CID 103824726
N-(4-bromo-3-chlorophenyl)-2-(oxolan-2-yl)acetamide (PubChem CID 103824726) has the molecular formula C12H13BrClNO2 and a molecular weight of 318.60 g/mol. Its IUPAC name is N-(4-bromo-3-chlorophenyl)-2-(oxolan-2-yl)acetamide.
| Compound Name | N-(4-bromo-3-chlorophenyl)-2-(oxolan-2-yl)acetamide |
|---|---|
| PubChem CID | 103824726 |
| Molecular Formula | C12H13BrClNO2 |
| Molecular Weight | 318.60 g/mol |
| Exact Mass | 316.98 |
| IUPAC Name | N-(4-bromo-3-chlorophenyl)-2-(oxolan-2-yl)acetamide |
| SMILES | O=C(CC1CCCO1)Nc1ccc(Br)c(Cl)c1 |
| InChI | InChI=1S/C12H13BrClNO2/c13-10-4-3-8(6-11(10)14)15-12(16)7-9-2-1-5-17-9/h3-4,6,9H,1-2,5,7H2,(H,15,16) |
| InChIKey | FTCLNISOUHNTGW-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.60 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |