C14H18Cl2N2O2 — CID 109016147
N-(3,4-dichlorophenyl)-3-(oxolan-2-ylmethylamino)propanamide (PubChem CID 109016147) has the molecular formula C14H18Cl2N2O2 and a molecular weight of 317.22 g/mol. Its IUPAC name is N-(3,4-dichlorophenyl)-3-(oxolan-2-ylmethylamino)propanamide.
| Compound Name | N-(3,4-dichlorophenyl)-3-(oxolan-2-ylmethylamino)propanamide |
|---|---|
| PubChem CID | 109016147 |
| Molecular Formula | C14H18Cl2N2O2 |
| Molecular Weight | 317.22 g/mol |
| Exact Mass | 316.07 |
| IUPAC Name | N-(3,4-dichlorophenyl)-3-(oxolan-2-ylmethylamino)propanamide |
| SMILES | O=C(CCNCC1CCCO1)Nc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C14H18Cl2N2O2/c15-12-4-3-10(8-13(12)16)18-14(19)5-6-17-9-11-2-1-7-20-11/h3-4,8,11,17H,1-2,5-7,9H2,(H,18,19) |
| InChIKey | LAVFXPMQUKFPGA-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.22 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|