C15H18ClNO5 — CID 120688629
2-[2-chloro-4-[[2-(oxan-2-yl)acetyl]amino]phenoxy]acetic acid (PubChem CID 120688629) has the molecular formula C15H18ClNO5 and a molecular weight of 327.76 g/mol. Its IUPAC name is 2-[2-chloro-4-[[2-(oxan-2-yl)acetyl]amino]phenoxy]acetic acid.
| Compound Name | 2-[2-chloro-4-[[2-(oxan-2-yl)acetyl]amino]phenoxy]acetic acid |
|---|---|
| PubChem CID | 120688629 |
| Molecular Formula | C15H18ClNO5 |
| Molecular Weight | 327.76 g/mol |
| Exact Mass | 327.09 |
| IUPAC Name | 2-[2-chloro-4-[[2-(oxan-2-yl)acetyl]amino]phenoxy]acetic acid |
| SMILES | O=C(O)COc1ccc(NC(=O)CC2CCCCO2)cc1Cl |
| InChI | InChI=1S/C15H18ClNO5/c16-12-7-10(4-5-13(12)22-9-15(19)20)17-14(18)8-11-3-1-2-6-21-11/h4-5,7,11H,1-3,6,8-9H2,(H,17,18)(H,19,20) |
| InChIKey | HSWGFZAREZVVCB-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.76 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |