C13H16ClNO6S — CID 146130981
2-[2-chloro-4-[[(2R)-oxolan-2-yl]methylsulfamoyl]phenoxy]acetic acid (PubChem CID 146130981) has the molecular formula C13H16ClNO6S and a molecular weight of 349.79 g/mol. Its IUPAC name is 2-[2-chloro-4-[[(2R)-oxolan-2-yl]methylsulfamoyl]phenoxy]acetic acid.
| Compound Name | 2-[2-chloro-4-[[(2R)-oxolan-2-yl]methylsulfamoyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 146130981 |
| Molecular Formula | C13H16ClNO6S |
| Molecular Weight | 349.79 g/mol |
| Exact Mass | 349.04 |
| IUPAC Name | 2-[2-chloro-4-[[(2R)-oxolan-2-yl]methylsulfamoyl]phenoxy]acetic acid |
| SMILES | O=C(O)COc1ccc(S(=O)(=O)NC[C@H]2CCCO2)cc1Cl |
| InChI | InChI=1S/C13H16ClNO6S/c14-11-6-10(3-4-12(11)21-8-13(16)17)22(18,19)15-7-9-2-1-5-20-9/h3-4,6,9,15H,1-2,5,7-8H2,(H,16,17)/t9-/m1/s1 |
| InChIKey | PYLZKGFDIHGBME-SECBINFHSA-N |
| XLogP | 1.26 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.79 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |