C17H27NO5S — CID 95864984
N-[[(2S)-oxolan-2-yl]methyl]-3,4-dipropoxybenzenesulfonamide (PubChem CID 95864984) has the molecular formula C17H27NO5S and a molecular weight of 357.47 g/mol. Its IUPAC name is N-[[(2S)-oxolan-2-yl]methyl]-3,4-dipropoxybenzenesulfonamide.
| Compound Name | N-[[(2S)-oxolan-2-yl]methyl]-3,4-dipropoxybenzenesulfonamide |
|---|---|
| PubChem CID | 95864984 |
| Molecular Formula | C17H27NO5S |
| Molecular Weight | 357.47 g/mol |
| Exact Mass | 357.16 |
| IUPAC Name | N-[[(2S)-oxolan-2-yl]methyl]-3,4-dipropoxybenzenesulfonamide |
| SMILES | CCCOc1ccc(S(=O)(=O)NC[C@@H]2CCCO2)cc1OCCC |
| InChI | InChI=1S/C17H27NO5S/c1-3-9-22-16-8-7-15(12-17(16)23-10-4-2)24(19,20)18-13-14-6-5-11-21-14/h7-8,12,14,18H,3-6,9-11,13H2,1-2H3/t14-/m0/s1 |
| InChIKey | ACTNVYWQGNCGON-AWEZNQCLSA-N |
| XLogP | 2.72 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.47 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |