C12H16INO4S — CID 34886718
4-iodo-3-methoxy-N-[[(2R)-oxolan-2-yl]methyl]benzenesulfonamide (PubChem CID 34886718) has the molecular formula C12H16INO4S and a molecular weight of 397.23 g/mol. Its IUPAC name is 4-iodo-3-methoxy-N-[[(2R)-oxolan-2-yl]methyl]benzenesulfonamide.
| Compound Name | 4-iodo-3-methoxy-N-[[(2R)-oxolan-2-yl]methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 34886718 |
| Molecular Formula | C12H16INO4S |
| Molecular Weight | 397.23 g/mol |
| Exact Mass | 396.98 |
| IUPAC Name | 4-iodo-3-methoxy-N-[[(2R)-oxolan-2-yl]methyl]benzenesulfonamide |
| SMILES | COc1cc(S(=O)(=O)NC[C@H]2CCCO2)ccc1I |
| InChI | InChI=1S/C12H16INO4S/c1-17-12-7-10(4-5-11(12)13)19(15,16)14-8-9-3-2-6-18-9/h4-5,7,9,14H,2-3,6,8H2,1H3/t9-/m1/s1 |
| InChIKey | CLWCGNQISNOQFO-SECBINFHSA-N |
| XLogP | 1.76 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.23 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|