C16H25NO4S — CID 40793365
4-butoxy-3-methyl-N-[[(2S)-oxolan-2-yl]methyl]benzenesulfonamide (PubChem CID 40793365) has the molecular formula C16H25NO4S and a molecular weight of 327.45 g/mol. Its IUPAC name is 4-butoxy-3-methyl-N-[[(2S)-oxolan-2-yl]methyl]benzenesulfonamide.
| Compound Name | 4-butoxy-3-methyl-N-[[(2S)-oxolan-2-yl]methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 40793365 |
| Molecular Formula | C16H25NO4S |
| Molecular Weight | 327.45 g/mol |
| Exact Mass | 327.15 |
| IUPAC Name | 4-butoxy-3-methyl-N-[[(2S)-oxolan-2-yl]methyl]benzenesulfonamide |
| SMILES | CCCCOc1ccc(S(=O)(=O)NC[C@@H]2CCCO2)cc1C |
| InChI | InChI=1S/C16H25NO4S/c1-3-4-9-21-16-8-7-15(11-13(16)2)22(18,19)17-12-14-6-5-10-20-14/h7-8,11,14,17H,3-6,9-10,12H2,1-2H3/t14-/m0/s1 |
| InChIKey | UXXOPIPVEIEISS-AWEZNQCLSA-N |
| XLogP | 2.63 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.45 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|