C14H21NO3S — CID 27243561
4-butoxy-3-methyl-N-prop-2-enylbenzenesulfonamide (PubChem CID 27243561) has the molecular formula C14H21NO3S and a molecular weight of 283.39 g/mol. Its IUPAC name is 4-butoxy-3-methyl-N-prop-2-enylbenzenesulfonamide.
| Compound Name | 4-butoxy-3-methyl-N-prop-2-enylbenzenesulfonamide |
|---|---|
| PubChem CID | 27243561 |
| Molecular Formula | C14H21NO3S |
| Molecular Weight | 283.39 g/mol |
| Exact Mass | 283.12 |
| IUPAC Name | 4-butoxy-3-methyl-N-prop-2-enylbenzenesulfonamide |
| SMILES | C=CCNS(=O)(=O)c1ccc(OCCCC)c(C)c1 |
| InChI | InChI=1S/C14H21NO3S/c1-4-6-10-18-14-8-7-13(11-12(14)3)19(16,17)15-9-5-2/h5,7-8,11,15H,2,4,6,9-10H2,1,3H3 |
| InChIKey | VRUSWVMLUXROBY-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.39 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|