C17H21ClN2O3S — CID 35202531
N-(5-chloro-2-pyridinyl)-3-methyl-4-pentoxybenzenesulfonamide (PubChem CID 35202531) has the molecular formula C17H21ClN2O3S and a molecular weight of 368.89 g/mol. Its IUPAC name is N-(5-chloro-2-pyridinyl)-3-methyl-4-pentoxybenzenesulfonamide.
| Compound Name | N-(5-chloro-2-pyridinyl)-3-methyl-4-pentoxybenzenesulfonamide |
|---|---|
| PubChem CID | 35202531 |
| Molecular Formula | C17H21ClN2O3S |
| Molecular Weight | 368.89 g/mol |
| Exact Mass | 368.10 |
| IUPAC Name | N-(5-chloro-2-pyridinyl)-3-methyl-4-pentoxybenzenesulfonamide |
| SMILES | CCCCCOc1ccc(S(=O)(=O)Nc2ccc(Cl)cn2)cc1C |
| InChI | InChI=1S/C17H21ClN2O3S/c1-3-4-5-10-23-16-8-7-15(11-13(16)2)24(21,22)20-17-9-6-14(18)12-19-17/h6-9,11-12H,3-5,10H2,1-2H3,(H,19,20) |
| InChIKey | DKOAMHRNUKBBCL-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.89 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|