C11H7ClF2N2O2S — CID 19683191
N-(5-chloro-2-pyridinyl)-3,4-difluorobenzenesulfonamide (PubChem CID 19683191) has the molecular formula C11H7ClF2N2O2S and a molecular weight of 304.71 g/mol. Its IUPAC name is N-(5-chloro-2-pyridinyl)-3,4-difluorobenzenesulfonamide.
| Compound Name | N-(5-chloro-2-pyridinyl)-3,4-difluorobenzenesulfonamide |
|---|---|
| PubChem CID | 19683191 |
| Molecular Formula | C11H7ClF2N2O2S |
| Molecular Weight | 304.71 g/mol |
| Exact Mass | 303.99 |
| IUPAC Name | N-(5-chloro-2-pyridinyl)-3,4-difluorobenzenesulfonamide |
| SMILES | O=S(=O)(Nc1ccc(Cl)cn1)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C11H7ClF2N2O2S/c12-7-1-4-11(15-6-7)16-19(17,18)8-2-3-9(13)10(14)5-8/h1-6H,(H,15,16) |
| InChIKey | ZJSVHZATFVSNDA-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.71 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |