C12H9ClN2O4S — CID 6463370
4-[(5-chloro-2-pyridinyl)sulfamoyl]benzoic acid (PubChem CID 6463370) has the molecular formula C12H9ClN2O4S and a molecular weight of 312.73 g/mol. Its IUPAC name is 4-[(5-chloro-2-pyridinyl)sulfamoyl]benzoic acid.
| Compound Name | 4-[(5-chloro-2-pyridinyl)sulfamoyl]benzoic acid |
|---|---|
| PubChem CID | 6463370 |
| Molecular Formula | C12H9ClN2O4S |
| Molecular Weight | 312.73 g/mol |
| Exact Mass | 312.00 |
| IUPAC Name | 4-[(5-chloro-2-pyridinyl)sulfamoyl]benzoic acid |
| SMILES | O=C(O)c1ccc(S(=O)(=O)Nc2ccc(Cl)cn2)cc1 |
| InChI | InChI=1S/C12H9ClN2O4S/c13-9-3-6-11(14-7-9)15-20(18,19)10-4-1-8(2-5-10)12(16)17/h1-7H,(H,14,15)(H,16,17) |
| InChIKey | SHBNUAVUZCYDRF-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 96.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.73 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |