C12H7Cl2F2NO2S — CID 3702957
N-(3,5-dichlorophenyl)-3,4-difluorobenzenesulfonamide (PubChem CID 3702957) has the molecular formula C12H7Cl2F2NO2S and a molecular weight of 338.16 g/mol. Its IUPAC name is N-(3,5-dichlorophenyl)-3,4-difluorobenzenesulfonamide.
| Compound Name | N-(3,5-dichlorophenyl)-3,4-difluorobenzenesulfonamide |
|---|---|
| PubChem CID | 3702957 |
| Molecular Formula | C12H7Cl2F2NO2S |
| Molecular Weight | 338.16 g/mol |
| Exact Mass | 336.95 |
| IUPAC Name | N-(3,5-dichlorophenyl)-3,4-difluorobenzenesulfonamide |
| SMILES | O=S(=O)(Nc1cc(Cl)cc(Cl)c1)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C12H7Cl2F2NO2S/c13-7-3-8(14)5-9(4-7)17-20(18,19)10-1-2-11(15)12(16)6-10/h1-6,17H |
| InChIKey | XSYKRJFLZYZRKN-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.16 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |