C13H9F4NO3S — CID 8504738
N-[4-(difluoromethoxy)phenyl]-3,4-difluorobenzenesulfonamide (PubChem CID 8504738) has the molecular formula C13H9F4NO3S and a molecular weight of 335.28 g/mol. Its IUPAC name is N-[4-(difluoromethoxy)phenyl]-3,4-difluorobenzenesulfonamide.
| Compound Name | N-[4-(difluoromethoxy)phenyl]-3,4-difluorobenzenesulfonamide |
|---|---|
| PubChem CID | 8504738 |
| Molecular Formula | C13H9F4NO3S |
| Molecular Weight | 335.28 g/mol |
| Exact Mass | 335.02 |
| IUPAC Name | N-[4-(difluoromethoxy)phenyl]-3,4-difluorobenzenesulfonamide |
| SMILES | O=S(=O)(Nc1ccc(OC(F)F)cc1)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C13H9F4NO3S/c14-11-6-5-10(7-12(11)15)22(19,20)18-8-1-3-9(4-2-8)21-13(16)17/h1-7,13,18H |
| InChIKey | SSIZIPIHAOWIRM-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.28 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |