C12H8ClF2NO2S — CID 5241140
4-chloro-N-(3,4-difluorophenyl)benzenesulfonamide (PubChem CID 5241140) has the molecular formula C12H8ClF2NO2S and a molecular weight of 303.72 g/mol. Its IUPAC name is 4-chloro-N-(3,4-difluorophenyl)benzenesulfonamide.
| Compound Name | 4-chloro-N-(3,4-difluorophenyl)benzenesulfonamide |
|---|---|
| PubChem CID | 5241140 |
| Molecular Formula | C12H8ClF2NO2S |
| Molecular Weight | 303.72 g/mol |
| Exact Mass | 302.99 |
| IUPAC Name | 4-chloro-N-(3,4-difluorophenyl)benzenesulfonamide |
| SMILES | O=S(=O)(Nc1ccc(F)c(F)c1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C12H8ClF2NO2S/c13-8-1-4-10(5-2-8)19(17,18)16-9-3-6-11(14)12(15)7-9/h1-7,16H |
| InChIKey | TZYPGJJFRHWUOW-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.72 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |