C12H8Cl2FNO2S — CID 711099
N-(3,4-dichlorophenyl)-4-fluorobenzenesulfonamide (PubChem CID 711099) has the molecular formula C12H8Cl2FNO2S and a molecular weight of 320.17 g/mol. Its IUPAC name is N-(3,4-dichlorophenyl)-4-fluorobenzenesulfonamide.
| Compound Name | N-(3,4-dichlorophenyl)-4-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 711099 |
| Molecular Formula | C12H8Cl2FNO2S |
| Molecular Weight | 320.17 g/mol |
| Exact Mass | 318.96 |
| IUPAC Name | N-(3,4-dichlorophenyl)-4-fluorobenzenesulfonamide |
| SMILES | O=S(=O)(Nc1ccc(Cl)c(Cl)c1)c1ccc(F)cc1 |
| InChI | InChI=1S/C12H8Cl2FNO2S/c13-11-6-3-9(7-12(11)14)16-19(17,18)10-4-1-8(15)2-5-10/h1-7,16H |
| InChIKey | SAEORURQKKGSBQ-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.17 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |