C19H15Cl2N3O3S — CID 4171462
1-[4-[(3,4-dichlorophenyl)sulfamoyl]phenyl]-3-phenylurea (PubChem CID 4171462) has the molecular formula C19H15Cl2N3O3S and a molecular weight of 436.32 g/mol. Its IUPAC name is 1-[4-[(3,4-dichlorophenyl)sulfamoyl]phenyl]-3-phenylurea.
| Compound Name | 1-[4-[(3,4-dichlorophenyl)sulfamoyl]phenyl]-3-phenylurea |
|---|---|
| PubChem CID | 4171462 |
| Molecular Formula | C19H15Cl2N3O3S |
| Molecular Weight | 436.32 g/mol |
| Exact Mass | 435.02 |
| IUPAC Name | 1-[4-[(3,4-dichlorophenyl)sulfamoyl]phenyl]-3-phenylurea |
| SMILES | O=C(Nc1ccccc1)Nc1ccc(S(=O)(=O)Nc2ccc(Cl)c(Cl)c2)cc1 |
| InChI | InChI=1S/C19H15Cl2N3O3S/c20-17-11-8-15(12-18(17)21)24-28(26,27)16-9-6-14(7-10-16)23-19(25)22-13-4-2-1-3-5-13/h1-12,24H,(H2,22,23,25) |
| InChIKey | UVPSSDRUHRDBOI-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.32 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |