C24H19ClN4O5S2 — CID 43904807
5-(benzenesulfonamido)-2-chloro-N-[4-(pyridin-3-ylsulfamoyl)phenyl]benzamide (PubChem CID 43904807) has the molecular formula C24H19ClN4O5S2 and a molecular weight of 543.03 g/mol. Its IUPAC name is 5-(benzenesulfonamido)-2-chloro-N-[4-(pyridin-3-ylsulfamoyl)phenyl]benzamide.
| Compound Name | 5-(benzenesulfonamido)-2-chloro-N-[4-(pyridin-3-ylsulfamoyl)phenyl]benzamide |
|---|---|
| PubChem CID | 43904807 |
| Molecular Formula | C24H19ClN4O5S2 |
| Molecular Weight | 543.03 g/mol |
| Exact Mass | 542.05 |
| IUPAC Name | 5-(benzenesulfonamido)-2-chloro-N-[4-(pyridin-3-ylsulfamoyl)phenyl]benzamide |
| SMILES | O=C(Nc1ccc(S(=O)(=O)Nc2cccnc2)cc1)c1cc(NS(=O)(=O)c2ccccc2)ccc1Cl |
| InChI | InChI=1S/C24H19ClN4O5S2/c25-23-13-10-18(28-35(31,32)20-6-2-1-3-7-20)15-22(23)24(30)27-17-8-11-21(12-9-17)36(33,34)29-19-5-4-14-26-16-19/h1-16,28-29H,(H,27,30) |
| InChIKey | QXYUQDGILJZDHH-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 134.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.03 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |