C22H17ClN4O5S3 — CID 43909921
5-(benzenesulfonamido)-2-chloro-N-[4-(1,3-thiazol-2-ylsulfamoyl)phenyl]benzamide (PubChem CID 43909921) has the molecular formula C22H17ClN4O5S3 and a molecular weight of 549.06 g/mol. Its IUPAC name is 5-(benzenesulfonamido)-2-chloro-N-[4-(1,3-thiazol-2-ylsulfamoyl)phenyl]benzamide.
| Compound Name | 5-(benzenesulfonamido)-2-chloro-N-[4-(1,3-thiazol-2-ylsulfamoyl)phenyl]benzamide |
|---|---|
| PubChem CID | 43909921 |
| Molecular Formula | C22H17ClN4O5S3 |
| Molecular Weight | 549.06 g/mol |
| Exact Mass | 548.00 |
| IUPAC Name | 5-(benzenesulfonamido)-2-chloro-N-[4-(1,3-thiazol-2-ylsulfamoyl)phenyl]benzamide |
| SMILES | O=C(Nc1ccc(S(=O)(=O)Nc2nccs2)cc1)c1cc(NS(=O)(=O)c2ccccc2)ccc1Cl |
| InChI | InChI=1S/C22H17ClN4O5S3/c23-20-11-8-16(26-34(29,30)17-4-2-1-3-5-17)14-19(20)21(28)25-15-6-9-18(10-7-15)35(31,32)27-22-24-12-13-33-22/h1-14,26H,(H,24,27)(H,25,28) |
| InChIKey | JHFCIGRPMALPDU-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 134.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.06 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |