C17H13N3O5S2 — CID 90474318
2-(phenylcarbamoyl)-4-(1,3-thiazol-2-ylsulfamoyl)benzoic acid (PubChem CID 90474318) has the molecular formula C17H13N3O5S2 and a molecular weight of 403.44 g/mol. Its IUPAC name is 2-(phenylcarbamoyl)-4-(1,3-thiazol-2-ylsulfamoyl)benzoic acid.
| Compound Name | 2-(phenylcarbamoyl)-4-(1,3-thiazol-2-ylsulfamoyl)benzoic acid |
|---|---|
| PubChem CID | 90474318 |
| Molecular Formula | C17H13N3O5S2 |
| Molecular Weight | 403.44 g/mol |
| Exact Mass | 403.03 |
| IUPAC Name | 2-(phenylcarbamoyl)-4-(1,3-thiazol-2-ylsulfamoyl)benzoic acid |
| SMILES | O=C(O)c1ccc(S(=O)(=O)Nc2nccs2)cc1C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C17H13N3O5S2/c21-15(19-11-4-2-1-3-5-11)14-10-12(6-7-13(14)16(22)23)27(24,25)20-17-18-8-9-26-17/h1-10H,(H,18,20)(H,19,21)(H,22,23) |
| InChIKey | QQQLAXPNMMCZEX-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 125.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.44 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |