C10H7ClN2O4S2 — CID 28536256
2-chloro-5-(1,3-thiazol-2-ylsulfamoyl)benzoic acid (PubChem CID 28536256) has the molecular formula C10H7ClN2O4S2 and a molecular weight of 318.76 g/mol. Its IUPAC name is 2-chloro-5-(1,3-thiazol-2-ylsulfamoyl)benzoic acid.
| Compound Name | 2-chloro-5-(1,3-thiazol-2-ylsulfamoyl)benzoic acid |
|---|---|
| PubChem CID | 28536256 |
| Molecular Formula | C10H7ClN2O4S2 |
| Molecular Weight | 318.76 g/mol |
| Exact Mass | 317.95 |
| IUPAC Name | 2-chloro-5-(1,3-thiazol-2-ylsulfamoyl)benzoic acid |
| SMILES | O=C(O)c1cc(S(=O)(=O)Nc2nccs2)ccc1Cl |
| InChI | InChI=1S/C10H7ClN2O4S2/c11-8-2-1-6(5-7(8)9(14)15)19(16,17)13-10-12-3-4-18-10/h1-5H,(H,12,13)(H,14,15) |
| InChIKey | PGUBVFDNBMUUNL-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 96.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.76 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |