C16H15ClN4O2S2 — CID 134602272
4-[[(R)-amino(phenyl)methyl]amino]-3-chloro-N-(1,3-thiazol-2-yl)benzenesulfonamide (PubChem CID 134602272) has the molecular formula C16H15ClN4O2S2 and a molecular weight of 394.91 g/mol. Its IUPAC name is 4-[[(R)-amino(phenyl)methyl]amino]-3-chloro-N-(1,3-thiazol-2-yl)benzenesulfonamide.
| Compound Name | 4-[[(R)-amino(phenyl)methyl]amino]-3-chloro-N-(1,3-thiazol-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 134602272 |
| Molecular Formula | C16H15ClN4O2S2 |
| Molecular Weight | 394.91 g/mol |
| Exact Mass | 394.03 |
| IUPAC Name | 4-[[(R)-amino(phenyl)methyl]amino]-3-chloro-N-(1,3-thiazol-2-yl)benzenesulfonamide |
| SMILES | N[C@H](Nc1ccc(S(=O)(=O)Nc2nccs2)cc1Cl)c1ccccc1 |
| InChI | InChI=1S/C16H15ClN4O2S2/c17-13-10-12(25(22,23)21-16-19-8-9-24-16)6-7-14(13)20-15(18)11-4-2-1-3-5-11/h1-10,15,20H,18H2,(H,19,21)/t15-/m1/s1 |
| InChIKey | TZTMBRNWDLOAJN-OAHLLOKOSA-N |
| XLogP | 3.67 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.91 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|