C15H14ClN5O2S2 — CID 134602241
4-[[(R)-amino(pyridin-2-yl)methyl]amino]-3-chloro-N-(1,3-thiazol-2-yl)benzenesulfonamide (PubChem CID 134602241) has the molecular formula C15H14ClN5O2S2 and a molecular weight of 395.90 g/mol. Its IUPAC name is 4-[[(R)-amino(pyridin-2-yl)methyl]amino]-3-chloro-N-(1,3-thiazol-2-yl)benzenesulfonamide.
| Compound Name | 4-[[(R)-amino(pyridin-2-yl)methyl]amino]-3-chloro-N-(1,3-thiazol-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 134602241 |
| Molecular Formula | C15H14ClN5O2S2 |
| Molecular Weight | 395.90 g/mol |
| Exact Mass | 395.03 |
| IUPAC Name | 4-[[(R)-amino(pyridin-2-yl)methyl]amino]-3-chloro-N-(1,3-thiazol-2-yl)benzenesulfonamide |
| SMILES | N[C@H](Nc1ccc(S(=O)(=O)Nc2nccs2)cc1Cl)c1ccccn1 |
| InChI | InChI=1S/C15H14ClN5O2S2/c16-11-9-10(25(22,23)21-15-19-7-8-24-15)4-5-12(11)20-14(17)13-3-1-2-6-18-13/h1-9,14,20H,17H2,(H,19,21)/t14-/m1/s1 |
| InChIKey | DNUFBQBEKMOYRE-CQSZACIVSA-N |
| XLogP | 3.06 |
| TPSA | 110.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.90 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|