C15H10Cl3N3O4S3 — CID 3577500
2,4,5-trichloro-N-[4-(1,3-thiazol-2-ylsulfamoyl)phenyl]benzenesulfonamide (PubChem CID 3577500) has the molecular formula C15H10Cl3N3O4S3 and a molecular weight of 498.82 g/mol. Its IUPAC name is 2,4,5-trichloro-N-[4-(1,3-thiazol-2-ylsulfamoyl)phenyl]benzenesulfonamide.
| Compound Name | 2,4,5-trichloro-N-[4-(1,3-thiazol-2-ylsulfamoyl)phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 3577500 |
| Molecular Formula | C15H10Cl3N3O4S3 |
| Molecular Weight | 498.82 g/mol |
| Exact Mass | 496.89 |
| IUPAC Name | 2,4,5-trichloro-N-[4-(1,3-thiazol-2-ylsulfamoyl)phenyl]benzenesulfonamide |
| SMILES | O=S(=O)(Nc1nccs1)c1ccc(NS(=O)(=O)c2cc(Cl)c(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C15H10Cl3N3O4S3/c16-11-7-13(18)14(8-12(11)17)28(24,25)20-9-1-3-10(4-2-9)27(22,23)21-15-19-5-6-26-15/h1-8,20H,(H,19,21) |
| InChIKey | QSRNDOQRJHBMKX-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 105.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.82 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|