C11H11ClN2O2S2 — CID 28719509
4-(2-chloroethyl)-N-(1,3-thiazol-2-yl)benzenesulfonamide (PubChem CID 28719509) has the molecular formula C11H11ClN2O2S2 and a molecular weight of 302.81 g/mol. Its IUPAC name is 4-(2-chloroethyl)-N-(1,3-thiazol-2-yl)benzenesulfonamide.
| Compound Name | 4-(2-chloroethyl)-N-(1,3-thiazol-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 28719509 |
| Molecular Formula | C11H11ClN2O2S2 |
| Molecular Weight | 302.81 g/mol |
| Exact Mass | 302.00 |
| IUPAC Name | 4-(2-chloroethyl)-N-(1,3-thiazol-2-yl)benzenesulfonamide |
| SMILES | O=S(=O)(Nc1nccs1)c1ccc(CCCl)cc1 |
| InChI | InChI=1S/C11H11ClN2O2S2/c12-6-5-9-1-3-10(4-2-9)18(15,16)14-11-13-7-8-17-11/h1-4,7-8H,5-6H2,(H,13,14) |
| InChIKey | IAYDXSHDMPVSMH-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.81 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|