C9H10BF4N3O2S2 — CID 139204733
[4-(1,3-thiazol-2-ylsulfamoyl)phenyl]azanium tetrafluoroborate (PubChem CID 139204733) has the molecular formula C9H10BF4N3O2S2 and a molecular weight of 343.14 g/mol. Its IUPAC name is [4-(1,3-thiazol-2-ylsulfamoyl)phenyl]azanium tetrafluoroborate.
| Compound Name | [4-(1,3-thiazol-2-ylsulfamoyl)phenyl]azanium tetrafluoroborate |
|---|---|
| PubChem CID | 139204733 |
| Molecular Formula | C9H10BF4N3O2S2 |
| Molecular Weight | 343.14 g/mol |
| Exact Mass | 343.02 |
| IUPAC Name | [4-(1,3-thiazol-2-ylsulfamoyl)phenyl]azanium tetrafluoroborate |
| SMILES | F[B-](F)(F)F.[NH3+]c1ccc(S(=O)(=O)Nc2nccs2)cc1 |
| InChI | InChI=1S/C9H9N3O2S2.BF4/c10-7-1-3-8(4-2-7)16(13,14)12-9-11-5-6-15-9;2-1(3,4)5/h1-6H,10H2,(H,11,12);/q;-1/p+1 |
| InChIKey | NTKFQODFBJMYHY-UHFFFAOYSA-O |
| XLogP | 2.12 |
| TPSA | 86.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.14 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|