C17H15ClN4O5S3 — CID 30391286
3-chloro-4-(methanesulfonamido)-N-[4-(1,3-thiazol-2-ylsulfamoyl)phenyl]benzamide (PubChem CID 30391286) has the molecular formula C17H15ClN4O5S3 and a molecular weight of 486.98 g/mol. Its IUPAC name is 3-chloro-4-(methanesulfonamido)-N-[4-(1,3-thiazol-2-ylsulfamoyl)phenyl]benzamide.
| Compound Name | 3-chloro-4-(methanesulfonamido)-N-[4-(1,3-thiazol-2-ylsulfamoyl)phenyl]benzamide |
|---|---|
| PubChem CID | 30391286 |
| Molecular Formula | C17H15ClN4O5S3 |
| Molecular Weight | 486.98 g/mol |
| Exact Mass | 485.99 |
| IUPAC Name | 3-chloro-4-(methanesulfonamido)-N-[4-(1,3-thiazol-2-ylsulfamoyl)phenyl]benzamide |
| SMILES | CS(=O)(=O)Nc1ccc(C(=O)Nc2ccc(S(=O)(=O)Nc3nccs3)cc2)cc1Cl |
| InChI | InChI=1S/C17H15ClN4O5S3/c1-29(24,25)21-15-7-2-11(10-14(15)18)16(23)20-12-3-5-13(6-4-12)30(26,27)22-17-19-8-9-28-17/h2-10,21H,1H3,(H,19,22)(H,20,23) |
| InChIKey | YOKVTPZBYVISFS-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 134.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.98 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |