C14H13ClN2O3S — CID 38014443
3-chloro-4-(methanesulfonamido)-N-phenylbenzamide (PubChem CID 38014443) has the molecular formula C14H13ClN2O3S and a molecular weight of 324.79 g/mol. Its IUPAC name is 3-chloro-4-(methanesulfonamido)-N-phenylbenzamide.
| Compound Name | 3-chloro-4-(methanesulfonamido)-N-phenylbenzamide |
|---|---|
| PubChem CID | 38014443 |
| Molecular Formula | C14H13ClN2O3S |
| Molecular Weight | 324.79 g/mol |
| Exact Mass | 324.03 |
| IUPAC Name | 3-chloro-4-(methanesulfonamido)-N-phenylbenzamide |
| SMILES | CS(=O)(=O)Nc1ccc(C(=O)Nc2ccccc2)cc1Cl |
| InChI | InChI=1S/C14H13ClN2O3S/c1-21(19,20)17-13-8-7-10(9-12(13)15)14(18)16-11-5-3-2-4-6-11/h2-9,17H,1H3,(H,16,18) |
| InChIKey | GTKHQUMCMSQIQN-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.79 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |