C14H11Cl2FN2O3S — CID 46778692
3-chloro-N-(3-chloro-4-fluorophenyl)-4-(methanesulfonamido)benzamide (PubChem CID 46778692) has the molecular formula C14H11Cl2FN2O3S and a molecular weight of 377.22 g/mol. Its IUPAC name is 3-chloro-N-(3-chloro-4-fluorophenyl)-4-(methanesulfonamido)benzamide.
| Compound Name | 3-chloro-N-(3-chloro-4-fluorophenyl)-4-(methanesulfonamido)benzamide |
|---|---|
| PubChem CID | 46778692 |
| Molecular Formula | C14H11Cl2FN2O3S |
| Molecular Weight | 377.22 g/mol |
| Exact Mass | 375.99 |
| IUPAC Name | 3-chloro-N-(3-chloro-4-fluorophenyl)-4-(methanesulfonamido)benzamide |
| SMILES | CS(=O)(=O)Nc1ccc(C(=O)Nc2ccc(F)c(Cl)c2)cc1Cl |
| InChI | InChI=1S/C14H11Cl2FN2O3S/c1-23(21,22)19-13-5-2-8(6-11(13)16)14(20)18-9-3-4-12(17)10(15)7-9/h2-7,19H,1H3,(H,18,20) |
| InChIKey | XPPCKUUHYSARHK-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.22 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |