C21H18ClFN4O3S2 — CID 15955499
N-[4-[[3-chloro-4-(methanesulfonamido)phenyl]carbamothioylamino]phenyl]-2-fluorobenzamide (PubChem CID 15955499) has the molecular formula C21H18ClFN4O3S2 and a molecular weight of 492.99 g/mol. Its IUPAC name is N-[4-[[3-chloro-4-(methanesulfonamido)phenyl]carbamothioylamino]phenyl]-2-fluorobenzamide.
| Compound Name | N-[4-[[3-chloro-4-(methanesulfonamido)phenyl]carbamothioylamino]phenyl]-2-fluorobenzamide |
|---|---|
| PubChem CID | 15955499 |
| Molecular Formula | C21H18ClFN4O3S2 |
| Molecular Weight | 492.99 g/mol |
| Exact Mass | 492.05 |
| IUPAC Name | N-[4-[[3-chloro-4-(methanesulfonamido)phenyl]carbamothioylamino]phenyl]-2-fluorobenzamide |
| SMILES | CS(=O)(=O)Nc1ccc(NC(=S)Nc2ccc(NC(=O)c3ccccc3F)cc2)cc1Cl |
| InChI | InChI=1S/C21H18ClFN4O3S2/c1-32(29,30)27-19-11-10-15(12-17(19)22)26-21(31)25-14-8-6-13(7-9-14)24-20(28)16-4-2-3-5-18(16)23/h2-12,27H,1H3,(H,24,28)(H2,25,26,31) |
| InChIKey | ABLXTILENPDUHD-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 99.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.99 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|