C15H14ClFN2O3S — CID 2811607
2-chloro-6-fluoro-N-[3-(methanesulfonamido)-4-methylphenyl]benzamide (PubChem CID 2811607) has the molecular formula C15H14ClFN2O3S and a molecular weight of 356.81 g/mol. Its IUPAC name is 2-chloro-6-fluoro-N-[3-(methanesulfonamido)-4-methylphenyl]benzamide.
| Compound Name | 2-chloro-6-fluoro-N-[3-(methanesulfonamido)-4-methylphenyl]benzamide |
|---|---|
| PubChem CID | 2811607 |
| Molecular Formula | C15H14ClFN2O3S |
| Molecular Weight | 356.81 g/mol |
| Exact Mass | 356.04 |
| IUPAC Name | 2-chloro-6-fluoro-N-[3-(methanesulfonamido)-4-methylphenyl]benzamide |
| SMILES | Cc1ccc(NC(=O)c2c(F)cccc2Cl)cc1NS(C)(=O)=O |
| InChI | InChI=1S/C15H14ClFN2O3S/c1-9-6-7-10(8-13(9)19-23(2,21)22)18-15(20)14-11(16)4-3-5-12(14)17/h3-8,19H,1-2H3,(H,18,20) |
| InChIKey | NLBNSFBLGVRCSG-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.81 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |