C15H10ClFN2OS — CID 2086523
2-chloro-6-fluoro-N-(2-methyl-1,3-benzothiazol-6-yl)benzamide (PubChem CID 2086523) has the molecular formula C15H10ClFN2OS and a molecular weight of 320.78 g/mol. Its IUPAC name is 2-chloro-6-fluoro-N-(2-methyl-1,3-benzothiazol-6-yl)benzamide.
| Compound Name | 2-chloro-6-fluoro-N-(2-methyl-1,3-benzothiazol-6-yl)benzamide |
|---|---|
| PubChem CID | 2086523 |
| Molecular Formula | C15H10ClFN2OS |
| Molecular Weight | 320.78 g/mol |
| Exact Mass | 320.02 |
| IUPAC Name | 2-chloro-6-fluoro-N-(2-methyl-1,3-benzothiazol-6-yl)benzamide |
| SMILES | Cc1nc2ccc(NC(=O)c3c(F)cccc3Cl)cc2s1 |
| InChI | InChI=1S/C15H10ClFN2OS/c1-8-18-12-6-5-9(7-13(12)21-8)19-15(20)14-10(16)3-2-4-11(14)17/h2-7H,1H3,(H,19,20) |
| InChIKey | SOJFRDFBZYRUDB-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.78 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |