C15H9F3N2OS — CID 30152613
2,3,4-trifluoro-N-(2-methyl-1,3-benzothiazol-6-yl)benzamide (PubChem CID 30152613) has the molecular formula C15H9F3N2OS and a molecular weight of 322.31 g/mol. Its IUPAC name is 2,3,4-trifluoro-N-(2-methyl-1,3-benzothiazol-6-yl)benzamide.
| Compound Name | 2,3,4-trifluoro-N-(2-methyl-1,3-benzothiazol-6-yl)benzamide |
|---|---|
| PubChem CID | 30152613 |
| Molecular Formula | C15H9F3N2OS |
| Molecular Weight | 322.31 g/mol |
| Exact Mass | 322.04 |
| IUPAC Name | 2,3,4-trifluoro-N-(2-methyl-1,3-benzothiazol-6-yl)benzamide |
| SMILES | Cc1nc2ccc(NC(=O)c3ccc(F)c(F)c3F)cc2s1 |
| InChI | InChI=1S/C15H9F3N2OS/c1-7-19-11-5-2-8(6-12(11)22-7)20-15(21)9-3-4-10(16)14(18)13(9)17/h2-6H,1H3,(H,20,21) |
| InChIKey | UHHITFSKEITDQO-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.31 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|