C10H13ClN2O3S — CID 166404140
2-chloro-N-[3-(methanesulfonamido)-4-methylphenyl]acetamide (PubChem CID 166404140) has the molecular formula C10H13ClN2O3S and a molecular weight of 276.75 g/mol. Its IUPAC name is 2-chloro-N-[3-(methanesulfonamido)-4-methylphenyl]acetamide.
| Compound Name | 2-chloro-N-[3-(methanesulfonamido)-4-methylphenyl]acetamide |
|---|---|
| PubChem CID | 166404140 |
| Molecular Formula | C10H13ClN2O3S |
| Molecular Weight | 276.75 g/mol |
| Exact Mass | 276.03 |
| IUPAC Name | 2-chloro-N-[3-(methanesulfonamido)-4-methylphenyl]acetamide |
| SMILES | Cc1ccc(NC(=O)CCl)cc1NS(C)(=O)=O |
| InChI | InChI=1S/C10H13ClN2O3S/c1-7-3-4-8(12-10(14)6-11)5-9(7)13-17(2,15)16/h3-5,13H,6H2,1-2H3,(H,12,14) |
| InChIKey | FXOHLCKNCXIFQG-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.75 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|