C16H16N2O5S — CID 146132998
4-[[3-(methanesulfonamido)-4-methylphenyl]carbamoyl]benzoic acid (PubChem CID 146132998) has the molecular formula C16H16N2O5S and a molecular weight of 348.38 g/mol. Its IUPAC name is 4-[[3-(methanesulfonamido)-4-methylphenyl]carbamoyl]benzoic acid.
| Compound Name | 4-[[3-(methanesulfonamido)-4-methylphenyl]carbamoyl]benzoic acid |
|---|---|
| PubChem CID | 146132998 |
| Molecular Formula | C16H16N2O5S |
| Molecular Weight | 348.38 g/mol |
| Exact Mass | 348.08 |
| IUPAC Name | 4-[[3-(methanesulfonamido)-4-methylphenyl]carbamoyl]benzoic acid |
| SMILES | Cc1ccc(NC(=O)c2ccc(C(=O)O)cc2)cc1NS(C)(=O)=O |
| InChI | InChI=1S/C16H16N2O5S/c1-10-3-8-13(9-14(10)18-24(2,22)23)17-15(19)11-4-6-12(7-5-11)16(20)21/h3-9,18H,1-2H3,(H,17,19)(H,20,21) |
| InChIKey | MDYSASCHMPCLSK-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 112.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.38 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |