C21H20N2O3S — CID 55705717
N-[3-(benzenesulfonamido)-4-methylphenyl]-4-methylbenzamide (PubChem CID 55705717) has the molecular formula C21H20N2O3S and a molecular weight of 380.47 g/mol. Its IUPAC name is N-[3-(benzenesulfonamido)-4-methylphenyl]-4-methylbenzamide.
| Compound Name | N-[3-(benzenesulfonamido)-4-methylphenyl]-4-methylbenzamide |
|---|---|
| PubChem CID | 55705717 |
| Molecular Formula | C21H20N2O3S |
| Molecular Weight | 380.47 g/mol |
| Exact Mass | 380.12 |
| IUPAC Name | N-[3-(benzenesulfonamido)-4-methylphenyl]-4-methylbenzamide |
| SMILES | Cc1ccc(C(=O)Nc2ccc(C)c(NS(=O)(=O)c3ccccc3)c2)cc1 |
| InChI | InChI=1S/C21H20N2O3S/c1-15-8-11-17(12-9-15)21(24)22-18-13-10-16(2)20(14-18)23-27(25,26)19-6-4-3-5-7-19/h3-14,23H,1-2H3,(H,22,24) |
| InChIKey | MMOIMQKOBKPQDR-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.47 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |